Bakuchiol 보골지염자
편집하기
Yuanje
(
토론
|
기여
)
님의 2023년 10월 1일 (일) 15:28 판
(
차이
)
← 이전 판
|
최신판
(
차이
) |
다음 판 →
(
차이
)
둘러보기로 이동
검색으로 이동
경고: 이 문서의 오래된 판을 편집하고 있습니다.
이것을 게시하면, 이 판 이후로 바뀐 모든 편집이 사라집니다.
경고:
로그인하지 않았습니다. 편집을 하면 IP 주소가 공개되게 됩니다.
로그인
하거나
계정을 생성하면
편집자가 사용자 이름으로 기록되고, 다른 장점도 있습니다.
스팸 방지 검사입니다. 이것을 입력하지
마세요
!
'''Bakuchiol''' is a meroterpene (a chemical compound having a partial terpenoid structure) in the class terpenophenol. It was first isolated in 1966 by Mehta et al. from Psoralea corylifolia seed and was called Bakuchiol based on the Sanskrit name of the plant, Bakuchi. Bakuchiol is a meroterpene phenol abundant in and mainly obtained from the seeds of the Psoralea corylifolia plant, which is widely used in Indian as well as in Traditional Chinese medicine to treat a variety of diseases. It has also been isolated from other plants, such as P. grandulosa, P. drupaceae, Ulmus davidiana, Otholobium pubescens, Piper longum and Aerva sangulnolenta Blum. Even though the first complete synthesis of Bakuchiol was described in 1973, its first commercial use in topical applications did not occur until 2007 when it was introduced to the market under the trade name Sytenol A by Sytheon Ltd. It has been reported to have anticancer activity in preclinical models, possibly due to its structural similarity with resveratrol. One study in rats suggested that Bakuchiol and ethanol extracts of the Chinese medicinal plant ''Psoralea corylifolia'' could protect against bone loss. Bakuchiol possesses antioxidant, anti-inflammatory, and antibacterial properties. Bakuchiol isolated from ''P. corylifolia'' has shown activity against numerous Gram-positive and Gram-negative oral pathogens. It was able to inhibit the growth of ''Streptococcus mutans'' under a range of sucrose concentrations, pH values and in the presence of organic acids in a temperature-dependent manner and also inhibited the growth of cells adhered to a glass surface. Despite having no structural resemblance to retinol, Bakuchiol was found to have retinol functionality through retinol-like regulation of gene expression. In 2018, a randomized, double-blind, 12-week clinical study with 44 volunteers demonstrated that Bakuchiol is comparable with retinol in its ability to improve photoaging (wrinkles, hyperpigmentation) but has a better skin tolerance. Bakuchiol has been found to possess antiandrogenic activity in prostate cancer cells, which inhibited cell proliferation. {{chembox|Verifiedfields=changed|Watchedfields=changed|verifiedrevid=459514403|Name=Bakuchiol|ImageFile=Bakuchiol.svg|ImageSize=250|ImageName=Chemical structure of bakuchiol|ImageAlt=Chemical structure of bakuchiol|PIN=4-[(1''E'',3''S'')-3-Ethenyl-3,7-dimethylocta-1,6-dien-1-yl]phenol|OtherNames=(+)-Bakuchiol<!-- <br /> -->|SystematicName=|Section1={{Chembox Identifiers | CASNo = 10309-37-2 | CASNo_Ref = {{cascite|correct|CAS}} | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 262344 | DrugBank = DB16102 | EC_number = 685-515-4 | PubChem = 5468522 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = OT12HJU3AR | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4579217 | SMILES = Oc1ccc(/C=C/[C@@](\C=C)(C)CC\C=C(/C)C)cc1 | InChI = 1/C18H24O/c1-5-18(4,13-6-7-15(2)3)14-12-16-8-10-17(19)11-9-16/h5,7-12,14,19H,1,6,13H2,2-4H3/b14-12+/t18-/m1/s1 | InChIKey = LFYJSSARVMHQJB-QIXNEVBVBX | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C18H24O/c1-5-18(4,13-6-7-15(2)3)14-12-16-8-10-17(19)11-9-16/h5,7-12,14,19H,1,6,13H2,2-4H3/b14-12+/t18-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = LFYJSSARVMHQJB-QIXNEVBVSA-N | MeSHName = }}|Section2={{Chembox Properties | Formula = C<sub>18</sub>H<sub>24</sub>O | MolarMass = 256.38 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }}|Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }}|Section4=|Section5=|Section6=}} {{chembox|Verifiedfields=changed|Watchedfields=changed|verifiedrevid=459514403|Name=Bakuchiol|ImageFile=Bakuchiol.svg|ImageSize=250|ImageName=Chemical structure of bakuchiol|ImageAlt=Chemical structure of bakuchiol|PIN=4-[(1''E'',3''S'')-3-Ethenyl-3,7-dimethylocta-1,6-dien-1-yl]phenol|OtherNames=(+)-Bakuchiol<!-- <br /> -->|SystematicName=|Section1={{Chembox Identifiers | CASNo = 10309-37-2 | CASNo_Ref = {{cascite|correct|CAS}} | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 262344 | DrugBank = DB16102 | EC_number = 685-515-4 | PubChem = 5468522 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = OT12HJU3AR | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4579217 | SMILES = Oc1ccc(/C=C/[C@@](\C=C)(C)CC\C=C(/C)C)cc1 | InChI = 1/C18H24O/c1-5-18(4,13-6-7-15(2)3)14-12-16-8-10-17(19)11-9-16/h5,7-12,14,19H,1,6,13H2,2-4H3/b14-12+/t18-/m1/s1 | InChIKey = LFYJSSARVMHQJB-QIXNEVBVBX | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C18H24O/c1-5-18(4,13-6-7-15(2)3)14-12-16-8-10-17(19)11-9-16/h5,7-12,14,19H,1,6,13H2,2-4H3/b14-12+/t18-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = LFYJSSARVMHQJB-QIXNEVBVSA-N | MeSHName = }}|Section2={{Chembox Properties | Formula = C<sub>18</sub>H<sub>24</sub>O | MolarMass = 256.38 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }}|Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }}|Section4=|Section5=|Section6=}} {{chembox|Verifiedfields=changed|Watchedfields=changed|verifiedrevid=459514403|Name=Bakuchiol|ImageFile=Bakuchiol.svg|ImageSize=250|ImageName=Chemical structure of bakuchiol|ImageAlt=Chemical structure of bakuchiol|PIN=4-[(1''E'',3''S'')-3-Ethenyl-3,7-dimethylocta-1,6-dien-1-yl]phenol|OtherNames=(+)-Bakuchiol<!-- <br /> -->|SystematicName=|Section1={{Chembox Identifiers | CASNo = 10309-37-2 | CASNo_Ref = {{cascite|correct|CAS}} | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 262344 | DrugBank = DB16102 | EC_number = 685-515-4 | PubChem = 5468522 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = OT12HJU3AR | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4579217 | SMILES = Oc1ccc(/C=C/[C@@](\C=C)(C)CC\C=C(/C)C)cc1 | InChI = 1/C18H24O/c1-5-18(4,13-6-7-15(2)3)14-12-16-8-10-17(19)11-9-16/h5,7-12,14,19H,1,6,13H2,2-4H3/b14-12+/t18-/m1/s1 | InChIKey = LFYJSSARVMHQJB-QIXNEVBVBX | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C18H24O/c1-5-18(4,13-6-7-15(2)3)14-12-16-8-10-17(19)11-9-16/h5,7-12,14,19H,1,6,13H2,2-4H3/b14-12+/t18-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = LFYJSSARVMHQJB-QIXNEVBVSA-N | MeSHName = }}|Section2={{Chembox Properties | Formula = C<sub>18</sub>H<sub>24</sub>O | MolarMass = 256.38 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }}|Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }}|Section4=|Section5=|Section6=}}
요약:
유안재 천연화장품 백과사전에서의 모든 기여는 다른 기여자가 편집, 수정, 삭제할 수 있다는 점을 유의해 주세요. 만약 여기에 동의하지 않는다면, 문서를 저장하지 말아 주세요.
또한, 직접 작성했거나 퍼블릭 도메인과 같은 자유 문서에서 가져왔다는 것을 보증해야 합니다(자세한 사항은
YUANJE WIKI:저작권
문서를 보세요).
저작권이 있는 내용을 허가 없이 저장하지 마세요!
취소
편집 도움말
(새 창에서 열림)
둘러보기 메뉴
개인 도구
로그인하지 않음
토론
기여
계정 만들기
로그인
이름공간
문서
토론
한국어
보기
읽기
편집
원본 편집
역사 보기
더 보기
둘러보기
대문
최근 바뀜
임의의 문서로
미디어위키 도움말
도구
여기를 가리키는 문서
가리키는 글의 최근 바뀜
특수 문서 목록
문서 정보